Cytidine triphosphate (CTP) is a nucleotide triphosphate consisting of a cytosine base, a ribose sugar, and three phosphate groups. It serves as a fundamental building block for RNA synthesis and plays a key role in cellular energy metabolism and lipid biosynthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 123334-07-6
Cytidine triphosphate
Nucleotide intermediate for RNA synthesis
Cytidine-5'-O-(1-thiotriphosphate)
nucleotide research reagent
Cytidine-5'-O-(1-thiotriphosphate)
biochemical research reagent
143028-98-2 (free acid)
nucleotide research reagent
Thymidine 5'-triphosphate sodium salt
nucleotide triphosphate research reagent
5-Methoxyuridine 5'-triphosphate
nucleotide triphosphate research reagent
Inosine 5'-(tetrahydrogen triphosphate), 2'-deoxy-, trisodium salt
nucleotide triphosphate research reagent
Menaquinone 7-d7
stable isotope labeled research compound
[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
PCDQPRRSZKQHHS-XVFCMESISA-N
C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O