This compound is a polychlorinated biphenyl derivative featuring a fully deuterium-labeled phenyl ring and a deuterium-labeled cyclohexadiene ring containing two chlorine substituents. It is a highly specific isotopically labeled research compound used in analytical and environmental studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1219804-50-8
Acamprosate-d12 Calcium (dipropyl-d12)
isotopically labeled research compound
L-Methionine-d3
isotopically labeled research compound
Rac Ambrisentan-d3 Methyl Ester
isotopically labeled research compound
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
2,4,5-trichloroaniline-d4
deuterated analytical reference standard
2,4-Difluorobenzoic Acid-d3
deuterated research compound
2-phenoxyethyl-1,1,2,2-d4 alcohol
deuterated research reference standard
4-N-Butylanisole-2,3,5,6-d4
deuterated research compound
3,6-dichloro-1,2,3,4,6-pentadeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)cyclohexa-1,4-diene
KQVWSTQXDLZRRK-YINOKFNYSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(C(=C(C2([2H])Cl)[2H])[2H])([2H])Cl)[2H])[2H])[2H]
—