This compound is a chemical compound used primarily as a research reagent. Its structure features a benzodioxole ring with two fluorine atoms, an aromatic ring, and hydroxyl and ether functional groups, giving it moderate polarity and low molecular weight.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1211539-82-0
Diacetic Aceclofenac
Impurity reference standard
3-CHLOROTOLUENE-D7
Deuterated analytical reference standard
P-21 nootropic peptide
nootropic peptide research compound
Epicatechin gallate
polyphenol with enzyme inhibition activity
2,2-difluoro-1,3-benzodioxol-5-ol
GEHVTOIGEVNIEQ-UHFFFAOYSA-N
C1=CC2=C(C=C1O)OC(O2)(F)F