Diacetic Aceclofenac is a chemical compound that serves as an impurity reference standard for aceclofenac. Structurally, it is a polar, multiple ester-containing derivative featuring two aromatic rings and a halogenated aniline moiety.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1216495-92-9
Acetic Aceclofenac
active pharmaceutical ingredient
Aseklofenak
Active pharmaceutical ingredient
(2-oxo-2-phenylmethoxyethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate
pharmaceutical impurity reference standard
Aceclofenac Ethyl Ester
Pharmaceutical intermediate for aceclofenac production
4-Methylbenzene-1-sulfonic acid--2-(2-methoxyethoxy)ethan-1-ol (1/1)
Impurity reference standard
5-Chloro-6-methyl-1,2,3-oxathiazin-4(3H)-one 2,2-dioxide
Impurity reference standard
3-CHLOROTOLUENE-D7
Deuterated analytical reference standard
P-21 nootropic peptide
nootropic peptide research compound
2-[2-[2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetyl]oxyacetyl]oxyacetic acid
ZCCRLKICIDWHKV-UHFFFAOYSA-N
C1=CC=C(C(=C1)CC(=O)OCC(=O)OCC(=O)OCC(=O)O)NC2=C(C=CC=C2Cl)Cl