7-bromo-1H-indole-3-carbaldehyde is a brominated indole derivative used as a research compound. Its structure features an indole core with a formyl group at the 3-position and a bromine atom at the 7-position, contributing to its utility in synthetic chemistry and biological studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 115666-21-2
Pseudouridine 5'-phosphate
research compound for RNA modification studies
1-Amino-3-phenylnaphthalene
Research compound
1,3-Bis(2,6-di(pentan-3-yl)phenyl)-1H-imidazol-3-ium chloride
research compound for organic synthesis
4-FLUORO-3-NITROPYRIDINE
Organic synthesis intermediate
7-bromo-1H-indole-3-carbaldehyde
MGPMWCBAOQWENZ-UHFFFAOYSA-N
C1=CC2=C(C(=C1)Br)NC=C2C=O