This compound is a chiral alcohol featuring a chlorophenyl ring, primarily used as a research reagent in stereochemistry studies. Its structure is marked with defined stereochemistry and contains an alcohol group, an aromatic ring, and a halogen substituent.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 112777-67-0
1-((R)-3-Amino-pyrrolidin-1-yl)-ethanone
chiral research compound
3-Fluoro-4-methoxyphenylmagnesium bromide
Grignard reagent for organic synthesis
2,6-dipyridin-2-yl-4-pyridin-4-ylpyridine
Research compound for supramolecular chemistry
D-FMOC-methionine
Protected amino acid for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(naphthalen-2-yl)propanoic acid
Research compound for peptide synthesis
(1S)-1-(3-chlorophenyl)propan-1-ol
pharmaceutical intermediate
(1R)-1-(3-chlorophenyl)propan-1-ol
APYGJPRINQKIQF-SECBINFHSA-N
CC[C@H](C1=CC(=CC=C1)Cl)O
—