This compound is a research reagent designed for supramolecular chemistry, featuring a structure with multiple aromatic and heterocyclic rings that facilitate alkylation of pendant pyridyl groups. It serves as a building block for developing supramolecular architectures through controlled self-assembly processes.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 112881-51-3
D-FMOC-methionine
Protected amino acid for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(naphthalen-2-yl)propanoic acid
Research compound for peptide synthesis
Trans-3,4-Difluorocinnamic acid
research compound
(2E)-3-(2,5-difluorophenyl)prop-2-enoic acid
research compound
2,6-dipyridin-2-yl-4-pyridin-4-ylpyridine
DPPKPCLKZOLTMB-UHFFFAOYSA-N
C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=NC=C4
—