This compound is a deuterium-labeled derivative of piperazine, specifically designed for research applications. Its primary significance is as a stable isotope-labeled reagent used in analytical and biochemical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1126621-86-0
8-Hydroxyquinoline 1-oxide
research compound
2,4-Dichloro-6-(naphthalen-2-yl)-1,3,5-triazine
research compound
(1R)-1-(3-chlorophenyl)propan-1-ol
chiral research compound
3-Fluoro-4-methoxyphenylmagnesium bromide
Grignard reagent for organic synthesis
1-Boc-piperazine
protecting group for piperazine synthesis
Tert-butyl Piperazine-1-carboxylate Hydrochloride
Pharmaceutical intermediate for drug synthesis
tert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate
CWXPZXBSDSIRCS-DUSUNJSHSA-N
[2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C(=O)OC(C)(C)C)([2H])[2H])[2H]