This compound is a research reagent featuring an oxabicyclohexane core, a bicyclic structure that includes an oxygen-containing three-membered ring. It is primarily used in laboratory settings for chemical synthesis and structure-activity relationship studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 110567-22-1
Tyr-ile-gly-ser-arg
synthetic laminin pentapeptide research reagent
Morpholine-d8 Hydrochloride
deuterated solvent reference standard
Spacer Phosphoramidite C3
oligonucleotide synthesis reagent
(1R,2R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride
isotope-labeled reference standard
(1S,2R,3S,5R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexane
YPDRJNPIGFCETD-WCIQWLHISA-N
C1[C@@H]2[C@@H](O2)[C@@H]([C@H]1OCC3=CC=CC=C3)COCC4=CC=CC=C4