Morpholine-d8 Hydrochloride is a deuterated research reagent used as a reference standard in nuclear magnetic resonance (NMR) spectroscopy. This isotopically labeled compound contains eight deuterium atoms, making it suitable for solvent calibration and analytical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1107650-56-5
MORPHOLINE-2,2,3,3,5,5,6,6-D8
deuterated research reagent
Spacer Phosphoramidite C3
oligonucleotide synthesis reagent
(1R,2R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride
isotope-labeled reference standard
Potassium (R)-3-hydroxybutanoate
research chemical
Ethyl (2R)-oxirane-2-carboxylate
Research compound
2,2,6,6-d4-Morpholine
deuterated standard for analytical chemistry
Morfolin
Solvent and chemical intermediate
2,2,3,3,5,5,6,6-octadeuteriomorpholine;hydrochloride
JXYZHMPRERWTPM-PHHTYKMFSA-N
[2H]C1(C(OC(C(N1)([2H])[2H])([2H])[2H])([2H])[2H])[2H].Cl