This compound is a protected amino acid derivative used in peptide synthesis. Its significance lies in the orthogonal protection of the histidine side chain, enabling selective incorporation of histidine into synthetic peptides.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 109425-51-6
Fmoc-His(Trt)-Gly-OH
Peptide synthesis building block
(S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1-trityl-1H-imidazol-4-yl)propanamido)-2-methylpropanoic acid
Research compound for peptide synthesis
Tert-butyl (3R)-3-hydroxypyrrolidine-1-carboxylate
Pharmaceutical intermediate for API synthesis
Methyl 5-(chlorosulfonyl)-2-fluorobenzoate
Pharmaceutical intermediate
Sildenafil N-Oxide
pharmaceutical impurity reference standard
Zolpidem 6-Carboxylic Acid
impurity reference standard for zolpidem
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-[1-(triphenylmethyl)-1H-imidazol-4-yl]propanoic acid
Protected amino acid for peptide synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoic acid
XXMYDXUIZKNHDT-QNGWXLTQSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)C[C@@H](C(=O)O)NC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57