This compound is a pharmaceutical intermediate carrying a chiral secondary amine and a carboxylic acid group, specifically designed for the synthesis of phenylephrine-related molecules. Its structure features a single aromatic ring with both alcohol and acid functional groups, making it a polar, hydrogen-bond-donating building block.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1094089-46-9
N-Fmoc-N'-trityl-L-histidine
Protected amino acid for peptide synthesis
Tert-butyl (3R)-3-hydroxypyrrolidine-1-carboxylate
Pharmaceutical intermediate for API synthesis
Methyl 5-(chlorosulfonyl)-2-fluorobenzoate
Pharmaceutical intermediate
Sildenafil N-Oxide
pharmaceutical impurity reference standard
2-[[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]acetic acid
HIYGSKMMSXCQJE-JTQLQIEISA-N
CN(C[C@@H](C1=CC(=CC=C1)O)O)CC(=O)O
—