This compound is a deuterium-labeled form of isopropylamine hydrochloride, primarily used as a research reagent. The incorporation of seven deuterium atoms makes it valuable for tracing and analytical studies in chemical and biological research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 106658-10-0
1,1,1,2,3,3,3-heptadeuteriopropan-2-amine
deuterated research compound
(S)-Ru(OAc)2(T-BINAP)
chiral catalyst for asymmetric synthesis
Isopropylmagnesium Chloride
Grignard reagent for organic synthesis
Aminomalonic acid
metabolite research reagent
(S)-morpholine-3-carboxylic acid
research compound
ISO-PROPYL-1,1,1,3,3,3-D6-AMINE
deuterated research reagent
2-Propanamine
Solvent and chemical intermediate
1,1,1,2,3,3,3-heptadeuteriopropan-2-amine;hydrochloride
ISYORFGKSZLPNW-NDCOIKGTSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])N.Cl