This compound is a deuterated form of isopropylamine, where all seven hydrogen atoms in the methyl groups and the methine position are replaced with deuterium. It is primarily used as a research reagent in studies involving isotopic labeling.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 106658-09-7
Iso-Propyl-d7-amine HCl
Research compound with deuterium labeling
(S)-Ru(OAc)2(T-BINAP)
chiral catalyst for asymmetric synthesis
Isopropylmagnesium Chloride
Grignard reagent for organic synthesis
Aminomalonic acid
metabolite research reagent
(S)-morpholine-3-carboxylic acid
research compound
ISO-PROPYL-1,1,1,3,3,3-D6-AMINE
deuterated research reagent
2-Propanamine
Solvent and chemical intermediate
1,1,1,2,3,3,3-heptadeuteriopropan-2-amine
JJWLVOIRVHMVIS-YYWVXINBSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])N