TAPSO sodium salt is a sodium salt of a sulfonic acid buffering agent. It is commonly utilized as a biological buffer reagent in research and laboratory settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 105140-25-8
MES potassium salt
biological buffer reagent
DIPSO sodium salt
biological buffer reagent
POPSO
biological buffer reagent
TES sodium salt
biological buffer reagent
5-Chloroindole-2-carboxylic acid
indolyl carboxylic acid reagent
3,5-Difluorophenylacetic acid
research compound
2-Propenoic acid, 2-phosphonoxy-, monocyclohexylammonium salt
Research compound
Guanosine 5'-triphosphate-5'-adenosine
Nucleoside polyphosphate research reagent
sodium 3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-hydroxypropane-1-sulfonate
XRADYQRMWVBZEH-UHFFFAOYSA-M
C(C(CS(=O)(=O)[O-])O)NC(CO)(CO)CO.[Na+]