TES sodium salt is a zwitterionic biological buffer reagent commonly used in biochemical and molecular biology research. It is the sodium salt form of TES (N-tris(hydroxymethyl)methyl-2-aminoethanesulfonic acid) and is valued for its effective buffering capacity in the physiological pH range.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 70331-82-7
3-[N-Tris-(hydroxymethyl)methylamino]propanesulphonic acid, sodium salt
biological buffer research reagent
4-Morpholinepropanesulfonic acid, sodium salt
biological buffer reagent
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid
biological buffer reagent
ADA sodium salt
biological buffer reagent
DIPSO sodium salt
biological buffer reagent
4-Piperidinepropanol
Research compound
Glycyl-L-proline
dipeptide research reagent
1H-Indazole-6-carboxylic acid
heterocyclic building block for research
sodium 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]ethanesulfonate
GUXMFAHOYNRHBI-UHFFFAOYSA-M
C(CS(=O)(=O)[O-])NC(CO)(CO)CO.[Na+]