This compound is a protected amino acid derivative used as a building block in peptide synthesis. Its structure incorporates a tert-butoxycarbonyl (Boc) protecting group and a homophenylalanine backbone, making it suitable for solid-phase or solution-phase peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 100564-78-1
H-D-PEN(TRT)-OH
Peptide building block for synthesis
Fmoc-Ile-Aib-OH
Peptide building block for synthesis
5-Nitroso-2,4,6-triaminopyrimidine
pharmaceutical intermediate for folic acid and drugs
2-Bromo-4-fluorobenzoic acid
Pharmaceutical intermediate for drug synthesis
O-Acetyl Losartan
pharmaceutical intermediate impurity
(alphaS)-alpha-(Chloromethyl)-3,4-difluorobenzenemethanol
Pharmaceutical intermediate
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid
MCODLPJUFHPVQP-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CCC1=CC=CC=C1)C(=O)O