This compound is a pharmaceutical intermediate, specifically a chiral alcohol bearing chlorine and fluorine substituents on an aromatic ring. It is primarily used in the synthesis of other chemical compounds for pharmaceutical research and manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1006376-60-8
(1R,2R)-2-(3,4-Difluorophenyl)cyclopropanecarboxamide
Pharmaceutical intermediate
(2S)-2-(3,4-difluorophenyl)oxirane
Pharmaceutical intermediate
1-(3-Bromo-4-fluorophenyl)ethanone
pharmaceutical intermediate
3-Bromo-4-fluorobenzoic acid
Pharmaceutical intermediate for synthesis
(1S)-2-chloro-1-(3,4-difluorophenyl)ethanol
RYOLLNVCYSUXCP-MRVPVSSYSA-N
C1=CC(=C(C=C1[C@@H](CCl)O)F)F