(-)-2-chloromandelic acid is a chiral aromatic hydroxy acid used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients. Its structure features an aromatic ring substituted with chlorine and a chiral alcohol-acid moiety, making it valuable for preparing stereochemically defined drug compounds.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 52950-18-2
2-Carboxymethyl-5-Methoxy-Benzoic Acid
pharmaceutical intermediate
Ethyl 4-hydroxyquinoline-3-carboxylate
Pharmaceutical intermediate
ACETYLSALICYLSALICYLIC ACID
Aspirin related impurity standard
2-Propan-1,1,1,3,3,3-d6-ol-d, 2-(methyl-d3)-
deuterated tert-butanol intermediate
2-Chloromandelic acid
research compound
(2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid
RWOLDZZTBNYTMS-SSDOTTSWSA-N
C1=CC=C(C(=C1)[C@H](C(=O)O)O)Cl