This compound is a deuterated form of tert-butanol, where all hydrogen atoms in the methyl groups and the hydroxyl group are replaced with deuterium. It is primarily used as a pharmaceutical intermediate in the synthesis of deuterated active pharmaceutical ingredients.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 53001-22-2
4-Amino-6-chloropyrimidine
Pharmaceutical intermediate
(2,3,4,5-tetrafluorophenyl)methanol
Pharmaceutical intermediate synthesis
1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (2S)-
Boc-protected amino acid intermediate
3-(4,5-Dihydro-1H-imidazol-2-yl)aniline monohydrochloride
pharmaceutical intermediate
Tert-Butanol
Solvent, denaturant, and gasoline additive
Zirconium(iv) t-butoxide
precursor for zirconium containing materials
2-Methyl-2-propan-d9-ol
Deuterated chemical intermediate for synthesis
2-Methylpropan-2-(2H)ol
Deuterated research reagent
1,1,1,3,3,3-hexadeuterio-2-deuteriooxy-2-(trideuteriomethyl)propane
DKGAVHZHDRPRBM-SGLLWXCUSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O[2H]