6-Bromo-L-tryptophan is a halogenated derivative of the amino acid L-tryptophan. It is commonly used as a research compound, particularly in studies involving the kynurenine pathway, which is the major route of tryptophan metabolism.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 52448-17-6
AFMK
Metabolite of melatonin and antioxidant
Dichloro(p-cymene)ruthenium(II) dimer
organometallic chemistry and homogeneous catalysis reagent
Dichloro(mesitylene)ruthenium(II) dimer
organoruthenium reagent for catalysis
2-(4-Bromophenyl)naphtho[1,2-d]oxazole
research compound
6-BROMO-DL-TRYPTOPHAN
research compound
(R)-2-Amino-3-(6-bromo-1H-indol-3-yl)propanoic acid
Peptide building block for research
(2S)-2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid
OAORYCZPERQARS-VIFPVBQESA-N
C1=CC2=C(C=C1Br)NC=C2C[C@@H](C(=O)O)N