H-AEEA-AEEA-AEEA is a highly flexible, water-soluble linker compound with multiple ether groups, two amide bonds, and terminal amine and carboxylic acid groups. It is primarily used as a research reagent in linker chemistry for constructing bioconjugates or functionalized molecules.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 2773558-06-6
Semaglutide impurity 50
Semaglutide process impurity or intermediate
2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid
pharmaceutical intermediate
Ethyl 4-(phenylmethoxy)-1H-indole-2-carboxylate
research compound
9-(2-bromophenyl-3,4,5,6-d4)-9H-carbazole-1,2,3,4,5,6,7,8-d8
deuterated research compound
(2-(9H-carbazol-9-yl-d8)phenyl-3,4,5,6-d4)boronic acid
deuterated research compound
9H-3,9'-bicarbazole-1,1',2,2',3',4,4',5,5',6,6',7,7',8,8'-d15
deuterated research compound
2-[2-[2-[[2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid
DLDHTLVGQUKJDC-UHFFFAOYSA-N
C(COCCOCC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)O)N