Fmoc-Glu(OAll)-OH is a research compound used in peptide synthesis, featuring a fluorenylmethoxycarbonyl (Fmoc) protecting group and an allyl ester side-chain protection. It is employed as a building block for the stepwise assembly of peptides, particularly where orthogonal deprotection strategies are required.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 133464-46-7
N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-glutamic-acid-alpha allyl ester
Fmoc-protected amino acid derivative
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-6-{[(prop-2-en-1-yloxy)carbonyl]amino}hexanoic acid
Protected amino acid for peptide synthesis
Alloc-Lys(Fmoc)-OH
protected amino acid for peptide synthesis
Fmoc-L-aspartic acid
research compound for peptide synthesis
Fmoc-Gln(Trt)-Thr(Psi(Me,Me)pro)-OH
research compound for peptide synthesis
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)glycylglycylglycine
research compound for peptide synthesis
Fmoc-Gln(Trt)-Ser(Psi(Me,Me)pro)-OH
research compound for peptide synthesis
(1,10-Phenanthroline)(trifluoromethyl)(triphenylphosphine)copper(I)
copper catalyst for cross-coupling reactions
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid
LRBARFFNYOKIAX-FQEVSTJZSA-N
C=CCOC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13