Pyrene is a polycyclic aromatic hydrocarbon consisting of four fused benzene rings, forming a flat aromatic structure. It is the smallest peri-fused PAH and serves as an intermediate in the production of other chemical compounds.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 129-00-0
9,10-Benzophenanthrene
polycyclic aromatic hydrocarbon intermediate
Phenol, 4,4'-(3,3,5-trimethylcyclohexylidene)bis-
bisphenol monomer for polymer production
Bis(4-methacryloylthiophenyl) Sulfide
crosslinking monomer for polymers
(3R,6R)-3,6-Octanediol
Industrial chemical intermediate
(trans,trans)-4-(But-3-en-1-yl)-4'-(p-tolyl)-1,1'-bi(cyclohexane)
liquid crystal intermediate
Pyrene D10
deuterated internal standard for analysis
1-Aminopyrene
fluorescent probe for chemical research
1-Bromopyrene
research compound
pyrene
BBEAQIROQSPTKN-UHFFFAOYSA-N
C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2