This compound is a bisphenol derivative containing two phenolic hydroxyl groups and a substituted cyclohexane ring, used as a monomer in polymer production. Its structure features two aromatic rings and a relatively high lipophilicity, contributing to its role as a building block in specialty polymers.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 129188-99-4
Bis(4-methacryloylthiophenyl) Sulfide
crosslinking monomer for polymers
(3R,6R)-3,6-Octanediol
Industrial chemical intermediate
(trans,trans)-4-(But-3-en-1-yl)-4'-(p-tolyl)-1,1'-bi(cyclohexane)
liquid crystal intermediate
Карбид алюминия
reducing agent and abrasive material
Phenol, 4,4'-cyclohexylidenebis[2-amino-
n.a
Bisphenol Z
n.a
4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol
UMPGNGRIGSEMTC-UHFFFAOYSA-N
CC1CC(CC(C1)(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)(C)C