This compound is a deuterium-labeled research reagent, specifically a bromoiodobenzene derivative with four deuterium atoms replacing hydrogen atoms on the aromatic ring. Its primary significance is as a stable isotope-labeled compound used in analytical and synthetic chemistry research.
Escopo do conteúdo: As informações desta página dizem respeito à identificação química e aos contextos de fornecimento industrial, pesquisa e produção. Não constituem alegação terapêutica, aconselhamento médico ou instruções de uso de medicamentos.
Adquirindo ou fornecendo este composto?
Publique seu inventário ou uma solicitação de compra
CAS 1147565-46-5
(R)-O-((2,2-Dimethyl-1,3-dioxolan-4-yl)methyl)hydroxylamine
organic synthesis intermediate
4,4,5,5-Tetramethyl-2-(3,3,3-trifluoropropyl)-1,3,2-dioxaborolane
Research reagent for synthetic chemistry
Diethyl 1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate
Hantzsch ester as redox probe
N-Carbobenzyloxy-L-valine
peptide synthesis reagent
1-Bromo-4-iodobenzene
research reagent for organic synthesis
1-bromo-2,3,5,6-tetradeuterio-4-iodobenzene
UCCUXODGPMAHRL-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1Br)[2H])[2H])I)[2H]