3-(Methoxycarbonyl)benzeneboronic Acid is a boronic acid reagent used primarily in chemical synthesis. It features an aromatic ring with an ester functional group and two hydroxyl groups on the boron atom, making it suitable for cross-coupling reactions and related laboratory applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-(Methoxycarbonyl)benzeneboronic Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(prop-1-en-2-yl)boronic acid
boronic acid reagent for synthesis
5-Chlorothiophene-2-boronic acid
boronic acid reagent for synthesis
3,5-Dichlorophenylboronic acid
boronic acid reagent for synthesis
2-Butoxyphenylboronic acid
boronic acid reagent for synthesis
L-Dilinoleoyllecithin
research compound
TERT-BUTYLBORONIC ACID PINACOL ESTER
research compound for boron chemistry
Arginyl-glycyl-aspartic acid
cell adhesion research tool
2-Chloro-5-Methoxypyrimidin-4-Amine
research chemical
(3-methoxycarbonylphenyl)boronic acid
ALTLCJHSJMGSLT-UHFFFAOYSA-N
B(C1=CC(=CC=C1)C(=O)OC)(O)O
3-(Methoxycarbonyl)benzeneboronic Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.