3,5-Dichlorophenylboronic acid is a boronic acid reagent used in organic synthesis. Its structure features an aromatic ring with two chlorine substituents and a boronic acid group, making it useful for carbon-carbon bond formation reactions such as Suzuki coupling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 67492-50-6
2-Butoxyphenylboronic acid
boronic acid reagent for synthesis
5-Bromo-2-methoxypyridine-4-boronic acid
boronic acid reagent for synthesis
3-(Methoxycarbonyl)benzeneboronic Acid
boronic acid reagent for synthesis
(prop-1-en-2-yl)boronic acid
boronic acid reagent for synthesis
METHYLMAGNESIUM CHLORIDE
Grignard reagent for organic synthesis
4-Azidopuromycin
research compound
N-Acetyl-D-mannosamine hydrate
Biochemical research reagent
(4,4'-Di-tert-butyl-2,2'-bipyridine)bis[(2-pyridinyl)phenyl]iridium(III) Hexafluorophosphate
phosphorescent organic light-emitting diode material
(3,5-dichlorophenyl)boronic acid
DKYRKAIKWFHQHM-UHFFFAOYSA-N
B(C1=CC(=CC(=C1)Cl)Cl)(O)O