This compound is a salt-like research reagent consisting of a boroxine derivative coordinated with pyridine. It is primarily used in boroxine chemistry for laboratory studies and material synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 95010-17-6
L-Serine-d2
isotopically labeled research compound
1,2-Ethanediol, 1,1,2-triphenyl-, 2-acetate, (2S)-
research compound
Ethyl 5-(hydroxymethyl)-3-phenylisoxazole-4-carboxylate
research compound
Magnesium bromide 3-methylthiophen-2-ide (1/1/1)
research reagent for synthesis
pyridine;2,4,6-tris(ethenyl)-1,3,5,2,4,6-trioxatriborinane
YLHJACXHRQQNQR-UHFFFAOYSA-N
B1(OB(OB(O1)C=C)C=C)C=C.C1=CC=NC=C1