Bis-2-ethylhexyl phthalate d4 is a deuterium-labeled derivative of the industrial chemical bis(2-ethylhexyl) phthalate, used primarily as a phthalate plasticizer. Its structure features a fully deuterated aromatic ring with two ester groups, contributing to its high flexibility and non-polar character.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 93951-87-2
Dioctyl phthalate-3,4,5,6-d4
Phthalate plasticizer research reference standard
2-bromo-1-phenylnaphthalene
chemical intermediate for organic synthesis
2-Hydroxyethyl benzoate
industrial intermediate for specialty chemicals
BENZOYL PEROXIDE
Polymerization catalyst and bleaching agent
Bis(2-ethylhexyl) phthalate
plasticizer for polymer materials
bis(2-ethylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
BJQHLKABXJIVAM-SAQXESPHSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCC(CC)CCCC)C(=O)OCC(CC)CCCC)[2H])[2H]