5-Carboxyfluorescein N-succinimidyl ester is a cell-permeable fluorescent dye that reacts with primary amines, commonly used in cell proliferation research. Its acetate-modified form, CFDA-SE, enhances cell permeability at the cost of fluorescence until intracellular activation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 92557-80-7
3'-AZido-2'3'-ddCTP
research compound for antiviral studies
2-Aminoethyl hydrogen sulfate
research compound
3-oxopropanoic acid
Research chemical and metabolite standard
Isobutylmagnesium Bromide
Grignard reagent for carbon-carbon bond formation
(2,5-dioxopyrrolidin-1-yl) 3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate
GECIDMICWWDIBO-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)C2=CC3=C(C=C2)C4(C5=C(C=C(C=C5)O)OC6=C4C=CC(=C6)O)OC3=O