3'-Azido-2',3'-dideoxycytidine 5'-triphosphate (3'-AZido-2'3'-ddCTP) is a nucleotide analog bearing an azido group at the 3' position of the deoxyribose moiety and a triphosphate chain. It is commonly employed as a research compound in antiviral studies, where its incorporation into nucleic acids can terminate chain elongation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3'-AZido-2'3'-ddCTP 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
DCTP
nucleotide triphosphate for DNA synthesis
[[(2S,3S,5R)-3-amino-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
n.a
6-(Benzyloxy)-9-((1S,3S)-4-(benzyloxy)-3-((benzyloxy)methyl)-2-methylenecyclopentyl)-N-((4-methoxyphenyl)diphenylmethyl)-9H-purin-2-amine
research compound for antiviral studies
2-Aminoethyl hydrogen sulfate
research compound
3-oxopropanoic acid
Research chemical and metabolite standard
Isobutylmagnesium Bromide
Grignard reagent for carbon-carbon bond formation
ISOPROPYL VINYL ETHER
vinyl ether monomer for polymerization
[[(2S,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-azidooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
KTLCZHWMPHUXRA-SHYZEUOFSA-N
C1[C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N=[N+]=[N-]
3'-AZido-2'3'-ddCTP 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.