3'-Amino-3'-dATP is a modified nucleotide analog used as a research reagent in molecular biology. It is primarily employed in nucleotide-related studies, such as investigating DNA polymerization or sequencing applications due to its 3'-amino group that can alter enzymatic activity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 90053-18-2
DATP
Pharmaceutical intermediate for nucleotide synthesis
DdATP
DNA sequencing reagent
Cytidine-5'-O-(1-thiotriphosphate)
nucleotide research reagent
143028-98-2 (free acid)
nucleotide research reagent
Guanosine 5'-(tetrahydrogen triphosphate), trisodium salt
nucleotide research reagent
Guanosine 5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt
nucleotide research reagent
3'-amino-2',3'-dideoxyguanosine 5'-(tetrahydrogen triphosphate)
Nucleotide analogue research reagent
JI-101
research compound
[[(2S,3S,5R)-3-amino-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
RTDWSTYJRAZSBP-RRKCRQDMSA-N
C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N