Pectin is a naturally occurring polysaccharide found in plant cell walls, commonly used as a gelling agent and thickener in food products. It is particularly valued for its ability to form gels in the presence of sugar and acid, making it essential for jams and jellies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 9000-69-5
Beta-D-glucose
nutrient replenisher and sweetener
Lysozyme (chicken egg white)
enzyme used in cheese production
Agar
Food thickener and gelling agent
Carboxymethylcellulose sodium salt
Food additive and thickener
D-Glucopyranuronic acid
Biochemical research reagent
(2S,3R,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid
AEMOLEFTQBMNLQ-DTEWXJGMSA-N
[C@@H]1([C@H]([C@H](O[C@H]([C@@H]1O)O)C(=O)O)O)O