(4-Chloro-3-cyanophenyl)boronic acid is a boronic acid derivative used as a pharmaceutical intermediate in chemical synthesis. Its structure features an aromatic ring substituted with a chloro group, a nitrile group, and a boronic acid moiety.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(4-Chloro-3-cyanophenyl)boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-((2S,5S)-5-((3R,5R)-5-Methyl-3-((methylsulfonyl)oxy)-6-(((trifluoromethyl)sulfonyl)oxy)hept-6-en-1-yl)-4-methylenetetrahydrofuran-2-yl)propyl pivalate
pharmaceutical intermediate
(1R,3S,5R,6R,7S,11R,14S,15S,16S,17R,18S,19S,20Z,22R,25S,28S,31S,33R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-16,17,19-tris[[tert-butyl(dimethyl)silyl]oxy]-22-hydroxy-6-methoxy-33-methyl-27,34-dimethylidene-4,35,36,37,38-pentaoxahexacyclo[29.3.1.111,15.114,18.125,28.03,7]octatriacont-20-en-9-one
pharmaceutical intermediate for complex polyether synthesis
1-Cinnamylpiperazine
Pharmaceutical intermediate for flunarizine
3-BROMOTHIOPHENE
Pharmaceutical intermediate for antibiotics and vasodilators
(4-chloro-3-cyanophenyl)boronic acid
PRPLADNLEYNYFZ-UHFFFAOYSA-N
B(C1=CC(=C(C=C1)Cl)C#N)(O)O
(4-Chloro-3-cyanophenyl)boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.