1-Cinnamylpiperazine is a chemical compound used as a pharmaceutical intermediate in the production of flunarizine, a calcium channel blocker. Its structure features a piperazine ring with a cinnamyl substituent, contributing to its role in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1-Cinnamylpiperazine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-BROMOTHIOPHENE
Pharmaceutical intermediate for antibiotics and vasodilators
5-Fluoropyridine-3-boronic acid
Pharmaceutical intermediate for synthesis
(R)-2-Aminopent-4-ynoic acid hydrochloride
Pharmaceutical intermediate for amino acid derivatives
Benzyl (S)-(-)-tetrahydro-5-oxo-3-furanylcarbamate
chemical intermediate for pharmaceutical synthesis
1-(3-Phenylprop-2-en-1-yl)piperazine--hydrogen chloride (1/1)
Pharmaceutical intermediate
1-[(E)-3-phenylprop-2-enyl]piperazine
WGEIOMTZIIOUMA-QPJJXVBHSA-N
C1CN(CCN1)C/C=C/C2=CC=CC=C2
1-Cinnamylpiperazine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.