Sodium pantothenate is the sodium salt of pantothenic acid, a water-soluble B vitamin (vitamin B5). It is an essential nutrient required by all animals for the synthesis of coenzyme A, which plays a critical role in cellular energy production and the metabolism of proteins, carbohydrates, and fats.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 867-81-2
Calcium pantothenate
Vitamin B5 dietary supplement
Potassium bitartrate
food acidity regulator and raising agent
Sodium tartrate
food emulsifier and sequestrant
CHOLINE BITARTRATE
dietary supplement and nutrient
L-tartaric acid
Food additive and acidulant
(+-)-Pantothenic acid
Vitamin B5 dietary supplement
Pantothenic acid
Vitamin B5 for dietary supplementation
sodium 3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoate
GQTHJBOWLPZUOI-FJXQXJEOSA-M
CC(C)(CO)[C@H](C(=O)NCCC(=O)[O-])O.[Na+]