Fmoc-Val-Cit-PAB-PNP is a research reagent used as a peptide conjugation reagent in laboratory settings. It features a complex molecular structure with multiple amide and ether groups, along with aromatic rings, making it suitable for specialized conjugation applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Fmoc-Val-Cit-PAB-PNP 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(9H-Fluoren-9-yl)methyl ((6S,9S)-1-amino-9-isopropyl-6-((4-((((4-nitrophenoxy)carbonyl)oxy)methyl)phenyl)carbamoyl)-1,8,11,14,17-pentaoxo-2,7,10,13,16-pentaazaoctadecan-18-yl)carbamate
research compound
Boc-Val-Cit-PAB-PNP
Antibody-drug conjugate linker reagent
Bz-Nle-Lys-Arg-Arg-AMC
fluorogenic substrate for proteases
Hexanedioic Acid Mono-(2-carboxyphenyl) Ester
reference standard for impurity analysis
(4-(5-bromo-2-chlorobenzyl)phenoxy)(tert-butyl)dimethylsilane
research compound
3-(9H-Carbazol-9-yl)phenylboronic acid
research compound for organic synthesis
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate
USMYACISHVPTHK-PXLJZGITSA-N
CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35
Fmoc-Val-Cit-PAB-PNP 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.