This compound is a brominated and chlorinated aromatic ether featuring a tert-butyl-dimethylsilyl protecting group. It is primarily used as a research reagent in chemical synthesis and laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-(9H-Carbazol-9-yl)phenylboronic acid
research compound for organic synthesis
Dideuterio(iodo)methane
Deuterated research reagent
Chloroform-D
NMR solvent
2-((6-Chloro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)methyl)benzonitrile
research compound
[4-[(5-bromo-2-chlorophenyl)methyl]phenoxy]-tert-butyl-dimethylsilane
DGZRKOVWOYLOAW-UHFFFAOYSA-N
CC(C)(C)[Si](C)(C)OC1=CC=C(C=C1)CC2=C(C=CC(=C2)Br)Cl
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.