(-)-Diisopinocampheyl chloroborane is a chiral borane reagent utilized in asymmetric synthesis. Its structure features multiple ring systems and a stereochemically defined boron center, making it valuable for enantioselective transformations in laboratory research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(-)-Diisopinocampheyl chloroborane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3,6-difluoropyridine-2-carboxylic Acid
research compound
Lidocaine D10
Isotope-labeled research reagent
5-chloro-2-methoxy-4-methylnicotinic acid
research compound
3-(3-Chloropropyl)-1,3-dihydro-7,8-dimethoxy-2H-3-benzazepin-2-one
research compound
Chlorobis[(1S,2R,3S,5S)-2,6,6-trimethylbicyclo[3.1.1]hept-3-yl]borane
asymmetric reducing agent and chiral reagent
chloro-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane
PSEHHVRCDVOTID-VMAIWCPRSA-N
B([C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C)([C@@H]3C[C@@H]4C[C@H]([C@H]3C)C4(C)C)Cl
(-)-Diisopinocampheyl chloroborane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.