Lidocaine D10 is a deuterium-labeled version of lidocaine, where ten hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in mass spectrometry and analytical chemistry for the quantification of lidocaine.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Lidocaine D10 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
5-chloro-2-methoxy-4-methylnicotinic acid
research compound
3-(3-Chloropropyl)-1,3-dihydro-7,8-dimethoxy-2H-3-benzazepin-2-one
research compound
(S)-Ethyl 2-phenyl-2-((S)-piperidin-2-yl)acetate hydrochloride
Research reference standard
2-(3-HYDROXY-1-PHENYLPROPYL)-4-METHYLPHENOL
organic synthesis research chemical
리도카인
local anesthetic and antiarrhythmic agent
Lidocaine hydrochloride monohydrate
active pharmaceutical ingredient
Lidocaine hydrochloride
local anesthetic active pharmaceutical ingredient
N-(2,6-dimethylphenyl)-2-[1,1,2,2,2-pentadeuterioethyl(2,2,2-trideuterioethyl)amino]acetamide
NNJVILVZKWQKPM-IXKWUQSXSA-N
[2H]C([2H])([2H])CN(CC(=O)NC1=C(C=CC=C1C)C)C([2H])([2H])C([2H])([2H])[2H]
Lidocaine D10 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.