Lidocaine D10 is a deuterium-labeled version of lidocaine, where ten hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in mass spectrometry and analytical chemistry for the quantification of lidocaine.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 851528-09-1
5-chloro-2-methoxy-4-methylnicotinic acid
research compound
3-(3-Chloropropyl)-1,3-dihydro-7,8-dimethoxy-2H-3-benzazepin-2-one
research compound
(S)-Ethyl 2-phenyl-2-((S)-piperidin-2-yl)acetate hydrochloride
Research reference standard
2-(3-HYDROXY-1-PHENYLPROPYL)-4-METHYLPHENOL
organic synthesis research chemical
리도카인
local anesthetic and antiarrhythmic agent
Lidocaine hydrochloride monohydrate
active pharmaceutical ingredient
Lidocaine hydrochloride
local anesthetic active pharmaceutical ingredient
N-(2,6-dimethylphenyl)-2-[1,1,2,2,2-pentadeuterioethyl(2,2,2-trideuterioethyl)amino]acetamide
NNJVILVZKWQKPM-IXKWUQSXSA-N
[2H]C([2H])([2H])CN(CC(=O)NC1=C(C=CC=C1C)C)C([2H])([2H])C([2H])([2H])[2H]