(R)-1-N-Boc-Pipecolamide is a chiral building block used in peptide synthesis. It features a tert-butoxycarbonyl (Boc) protecting group on the piperidine ring, making it suitable for solid-phase and solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 848488-91-5
Tert-Butyl (S)-2-carbamoylpyrrolidine-1-carboxylate
protected proline amide intermediate
Tert-Butyl 2-(aminocarbonyl)pyrrolidine-1-carboxylate
research compound
1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Boc-protected piperidine carboxylic acid intermediate
(S)-2-Aminobutyramide hydrochloride
peptide synthesis building block
Fmoc-beta-t-butyl-L-alanine
peptide synthesis building block
Fmoc-D-Cys(Trt)-OH
peptide synthesis building block
N-(tert-Butoxycarbonyl)-N-methyl-D-alanine
peptide synthesis building block
Tert-butyl N-[(1R)-1-(4-bromophenyl)-2-hydroxyethyl]carbamate
pharmaceutical intermediate
tert-butyl (2R)-2-carbamoylpiperidine-1-carboxylate
KIFYKONQFFJILQ-MRVPVSSYSA-N
CC(C)(C)OC(=O)N1CCCC[C@@H]1C(=O)N