This compound is a protected proline derivative featuring a tert-butoxycarbonyl (Boc) protecting group and a primary amide at the carboxyl terminus. It is commonly employed as a research reagent in peptide synthesis and biochemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 54503-10-5
(R)-1-N-Boc-Pipecolamide
peptide synthesis building block
Tert-butyl 2-carbamoylpiperidine-1-carboxylate
Pharmaceutical intermediate for peptide synthesis
(2R)-1-[(tert-butoxy)carbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid for peptide synthesis
Cycloheptylamine
Research compound
2,6-Pyridinedicarboxylic acid, dimethyl ester
research compound for crystallography
2'-o-(2-methoxyethyl)inosine
RNA modification research reagent
4-Bromo-1,8-naphthyridine
research compound
Tert-Butyl (S)-2-carbamoylpyrrolidine-1-carboxylate
protected proline amide intermediate
tert-butyl 2-carbamoylpyrrolidine-1-carboxylate
PITJAAIPVBVRAO-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCCC1C(=O)N