This compound is an Fmoc-protected amino acid derivative featuring a phthalimide-protected lysine side chain. It is primarily used as a building block in solid-phase peptide synthesis, enabling the selective incorporation of modified lysine residues.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(6-methoxypyridin-3-yl)propanoic acid
Fmoc-protected amino acid building block
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-methoxy-2-methylphenyl)propanoic acid
Fmoc-protected amino acid building block
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methyldec-9-enoic acid
Fmoc-protected amino acid building block
3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)propanoic acid
Fmoc-protected amino acid building block
2,3-다이클로로-5,6-다이사이아노-1,4-벤조퀴논
Oxidizing agent in steroid synthesis
N-((9H-Fluoren-9-ylmethoxy)carbonyl)-N-methyl-L-alanine
Peptide synthesis building block
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)-3-methylbutanoic acid
amino acid protecting reagent
Chitosan, 2-hydroxypropyl ether
pharmaceutical excipient raw material
(2S)-6-(1,3-dioxoisoindol-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid
MDYADJADRHFGPE-VWLOTQADSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN4C(=O)C5=CC=CC=C5C4=O)C(=O)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.