Minocycline Impurity 42 is a chemical compound used as a reference standard for the antibiotic minocycline. It is a complex polycyclic molecule featuring multiple amine, hydroxyl, and amide functional groups.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Minocycline Impurity 42 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
9-(Aminomethyl)minocycline
pharmaceutical intermediate
Minocycline Impurity 41
Minocycline impurity reference standard
Ethyl (S)-Nipecotate D-Tartrate
Pharmaceutical intermediate for nipecotate derivatives
(2S,4R)-1-[(tert-butoxy)carbonyl]-4-methoxypyrrolidine-2-carboxylic acid
Boc-protected proline derivative for peptide synthesis
(3R)-3-amino-3-phenylpropanoic acid hydrochloride
pharmaceutical intermediate for peptide synthesis
N,N-Dimethyl3-Bromo-4-(4-methylphenyl)-4-oxobutanamide
Pharmaceutical intermediate for impurity synthesis
(4S,4aS,5aR,12aR)-N,9-bis(aminomethyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide
MAZRSQPHSZXMHC-FLLYEPSDSA-N
CN(C)[C@H]1[C@@H]2C[C@@H]3CC4=C(C=C(C(=C4C(=C3C(=O)[C@@]2(C(=C(C1=O)C(=O)NCN)O)O)O)O)CN)N(C)C
Minocycline Impurity 42 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.