(3R)-3-Amino-3-phenylpropanoic acid hydrochloride is a chiral amino acid derivative used as a pharmaceutical intermediate. Its primary significance lies in serving as a building block for the synthesis of peptides and other active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(3R)-3-amino-3-phenylpropanoic acid hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-N-Fmoc-aminomethyl piperidine
pharmaceutical intermediate for peptide synthesis
L-tert-Leucine methyl ester hydrochloride
pharmaceutical intermediate for peptide synthesis
(S)-Boc-3-Amino-3-phenylpropan-1-ol
pharmaceutical intermediate for peptide synthesis
(2S)-2-amino-3,3-dimethylbutanamide hydrochloride
pharmaceutical intermediate for peptide synthesis
N,N-Dimethyl3-Bromo-4-(4-methylphenyl)-4-oxobutanamide
Pharmaceutical intermediate for impurity synthesis
2-Benzyloxy-5-bromopyridine
Pharmaceutical intermediate
5-Methoxyindole-3-butyric acid
pharmaceutical intermediate
7-chloro-4-(piperazin-1-yl)quinoline
pharmaceutical intermediate
(3R)-3-amino-3-phenylpropanoic acid;hydrochloride
ABEBCTCOPRULFS-DDWIOCJRSA-N
C1=CC=C(C=C1)[C@@H](CC(=O)O)N.Cl
(3R)-3-amino-3-phenylpropanoic acid hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.