Dehydrocholic acid is a steroidal bile acid derivative used as a pharmaceutical raw material. Its structure features multiple ketone groups and a carboxylic acid moiety, contributing to its role in pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 81-23-2
Glycodehydrocholic acid
bile acid glycine conjugate
Cholic acid
active pharmaceutical ingredient
Warfarin
anticoagulant active pharmaceutical ingredient
Ethylbisiminomethylguaiacol manganese chloride
Active pharmaceutical ingredient
Pravastatin
active pharmaceutical ingredient
Sodium dehydrocholate
bile acid
Taurodehydrocholate
bile acid research reagent
(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid
OHXPGWPVLFPUSM-KLRNGDHRSA-N
C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(C(=O)C[C@H]3[C@H]2C(=O)C[C@H]4[C@@]3(CCC(=O)C4)C)C