Dehydrocholic acid is a steroidal bile acid derivative used as a pharmaceutical raw material. Its structure features multiple ketone groups and a carboxylic acid moiety, contributing to its role in pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dehydrocholic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Glycodehydrocholic acid
bile acid glycine conjugate
Cholic acid
active pharmaceutical ingredient
Warfarin
anticoagulant active pharmaceutical ingredient
Ethylbisiminomethylguaiacol manganese chloride
Active pharmaceutical ingredient
Pravastatin
active pharmaceutical ingredient
Sodium dehydrocholate
bile acid
Taurodehydrocholate
bile acid research reagent
Dehydrocholic acid(CAS 81-23-2)의 국제 HS 코드는 2918.30입니다.
2918.30
2918 30 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid
OHXPGWPVLFPUSM-KLRNGDHRSA-N
C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(C(=O)C[C@H]3[C@H]2C(=O)C[C@H]4[C@@]3(CCC(=O)C4)C)C
Dehydrocholic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.