Taurodehydrocholate is a bile acid derivative used primarily as a research reagent in the study of bile acid chemistry and metabolism. Its structure includes a steroid backbone with multiple ketone groups and a taurine conjugate, making it a valuable tool for laboratory investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Taurodehydrocholate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Glycodehydrocholic acid
bile acid glycine conjugate
2-METHYL-D3-1,4-NAPHTHOQUINONE
deuterated analytical reference standard
2-amino-1-(pyridin-3-yl)ethanone
research compound
5-Amino-2,4-dichloropyrimidine
Chemical research compound
Dimidium bromide
research compound
Dehydrocholic acid
pharmaceutical raw material
Sodium dehydrocholate
bile acid
2-[[(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid
UBDJSBRKNHQFPD-PYGYYAGESA-N
C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@@H]2[C@@]1(C(=O)C[C@H]3[C@H]2C(=O)C[C@H]4[C@@]3(CCC(=O)C4)C)C
Taurodehydrocholate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.