This compound is a deuterated research reference standard used for analytical and laboratory applications. It is a heptadeuterated derivative of naphthalen-2-ol, featuring multiple deuterium atoms for isotopic labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Naphthol-1,3,4,5,6,7,8-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-(Acetyl-d3)-bromobenzene
Deuterated research reference standard
4-Chlorobiphenyl-2',3',4',5',6'-d5
Deuterated research reference standard
Ethylene Urea-d4
Deuterated research reference standard
2-METHOXYPHENOL-3,4,5,6-D4
Deuterated research reference standard
1-Aminonaphthalene-d9
deuterated research reagent
(3-acetamidophenyl)boronic acid
research compound for organic synthesis
2-NITROPYRENE
research compound
Oxalyl chloride
chlorinating reagent in organic synthesis
2-Naphthol-1,3,4,5,6,7,8-d7(CAS 78832-54-9)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,3,4,5,6,7,8-heptadeuterionaphthalen-2-ol
JWAZRIHNYRIHIV-GSNKEKJESA-N
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])O)[2H])[2H])[2H]
2-Naphthol-1,3,4,5,6,7,8-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.