1-Aminonaphthalene-d9 is a deuterated research reagent where all hydrogen atoms in the naphthalene ring and the amino group are replaced by deuterium. It is primarily used as a stable isotope-labeled compound for analytical and research applications, particularly in mass spectrometry and metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1-Aminonaphthalene-d9 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-NAPHTHOL-D8
Deuterated naphthol reference standard
(3-acetamidophenyl)boronic acid
research compound for organic synthesis
2-NITROPYRENE
research compound
Oxalyl chloride
chlorinating reagent in organic synthesis
1-나프틸아민
intermediate for dyes and antioxidants
1-Aminonaphthalene-d7
deuterated research standard
N,N,2,3,4,5,6,7,8-nonadeuterionaphthalen-1-amine
RUFPHBVGCFYCNW-CPTGGYHJSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2N([2H])[2H])[2H])[2H])[2H])[2H])[2H]
1-Aminonaphthalene-d9 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.